C29H30F2NO6S- — CID 18188538
6-[3-[1-(difluoromethoxy)-8-(methanesulfonamido)-6H-benzo[c]chromen-6-yl]phenyl]-2-ethylhexanoate (PubChem CID 18188538) has the molecular formula C29H30F2NO6S- and a molecular weight of 558.62 g/mol. Its IUPAC name is 6-[3-[1-(difluoromethoxy)-8-(methanesulfonamido)-6H-benzo[c]chromen-6-yl]phenyl]-2-ethylhexanoate.
| Compound Name | 6-[3-[1-(difluoromethoxy)-8-(methanesulfonamido)-6H-benzo[c]chromen-6-yl]phenyl]-2-ethylhexanoate |
|---|---|
| PubChem CID | 18188538 |
| Molecular Formula | C29H30F2NO6S- |
| Molecular Weight | 558.62 g/mol |
| Exact Mass | 558.18 |
| IUPAC Name | 6-[3-[1-(difluoromethoxy)-8-(methanesulfonamido)-6H-benzo[c]chromen-6-yl]phenyl]-2-ethylhexanoate |
| SMILES | CCC(CCCCc1cccc(C2Oc3cccc(OC(F)F)c3-c3ccc(NS(C)(=O)=O)cc32)c1)C(=O)[O-] |
| InChI | InChI=1S/C29H31F2NO6S/c1-3-19(28(33)34)10-5-4-8-18-9-6-11-20(16-18)27-23-17-21(32-39(2,35)36)14-15-22(23)26-24(37-27)12-7-13-25(26)38-29(30)31/h6-7,9,11-17,19,27,29,32H,3-5,8,10H2,1-2H3,(H,33,34)/p-1 |
| InChIKey | CZEJBOZVWCRPDW-UHFFFAOYSA-M |
| XLogP | 5.30 |
| TPSA | 104.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.62 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|