C26H26N2O4S — CID 10276481
N-[6-[3-(4-cyanobutyl)phenyl]-1-methoxy-6H-benzo[c]chromen-8-yl]methanesulfonamide (PubChem CID 10276481) has the molecular formula C26H26N2O4S and a molecular weight of 462.57 g/mol. Its IUPAC name is N-[6-[3-(4-cyanobutyl)phenyl]-1-methoxy-6H-benzo[c]chromen-8-yl]methanesulfonamide.
| Compound Name | N-[6-[3-(4-cyanobutyl)phenyl]-1-methoxy-6H-benzo[c]chromen-8-yl]methanesulfonamide |
|---|---|
| PubChem CID | 10276481 |
| Molecular Formula | C26H26N2O4S |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | N-[6-[3-(4-cyanobutyl)phenyl]-1-methoxy-6H-benzo[c]chromen-8-yl]methanesulfonamide |
| SMILES | COc1cccc2c1-c1ccc(NS(C)(=O)=O)cc1C(c1cccc(CCCCC#N)c1)O2 |
| InChI | InChI=1S/C26H26N2O4S/c1-31-23-11-7-12-24-25(23)21-14-13-20(28-33(2,29)30)17-22(21)26(32-24)19-10-6-9-18(16-19)8-4-3-5-15-27/h6-7,9-14,16-17,26,28H,3-5,8H2,1-2H3 |
| InChIKey | MUPCYKYFWJQFOP-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|