C19H16ClNO4S2 — CID 10202414
N-[6-(5-chlorothiophen-2-yl)-1-methoxy-6H-benzo[c]chromen-8-yl]methanesulfonamide (PubChem CID 10202414) has the molecular formula C19H16ClNO4S2 and a molecular weight of 421.93 g/mol. Its IUPAC name is N-[6-(5-chlorothiophen-2-yl)-1-methoxy-6H-benzo[c]chromen-8-yl]methanesulfonamide.
| Compound Name | N-[6-(5-chlorothiophen-2-yl)-1-methoxy-6H-benzo[c]chromen-8-yl]methanesulfonamide |
|---|---|
| PubChem CID | 10202414 |
| Molecular Formula | C19H16ClNO4S2 |
| Molecular Weight | 421.93 g/mol |
| Exact Mass | 421.02 |
| IUPAC Name | N-[6-(5-chlorothiophen-2-yl)-1-methoxy-6H-benzo[c]chromen-8-yl]methanesulfonamide |
| SMILES | COc1cccc2c1-c1ccc(NS(C)(=O)=O)cc1C(c1ccc(Cl)s1)O2 |
| InChI | InChI=1S/C19H16ClNO4S2/c1-24-14-4-3-5-15-18(14)12-7-6-11(21-27(2,22)23)10-13(12)19(25-15)16-8-9-17(20)26-16/h3-10,19,21H,1-2H3 |
| InChIKey | XRFVXNDDKUKKAH-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.93 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |