C22H18N2O4S — CID 10158247
N-[6-(3-cyanophenyl)-1-methoxy-6H-benzo[c]chromen-8-yl]methanesulfonamide (PubChem CID 10158247) has the molecular formula C22H18N2O4S and a molecular weight of 406.46 g/mol. Its IUPAC name is N-[6-(3-cyanophenyl)-1-methoxy-6H-benzo[c]chromen-8-yl]methanesulfonamide.
| Compound Name | N-[6-(3-cyanophenyl)-1-methoxy-6H-benzo[c]chromen-8-yl]methanesulfonamide |
|---|---|
| PubChem CID | 10158247 |
| Molecular Formula | C22H18N2O4S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | N-[6-(3-cyanophenyl)-1-methoxy-6H-benzo[c]chromen-8-yl]methanesulfonamide |
| SMILES | COc1cccc2c1-c1ccc(NS(C)(=O)=O)cc1C(c1cccc(C#N)c1)O2 |
| InChI | InChI=1S/C22H18N2O4S/c1-27-19-7-4-8-20-21(19)17-10-9-16(24-29(2,25)26)12-18(17)22(28-20)15-6-3-5-14(11-15)13-23/h3-12,22,24H,1-2H3 |
| InChIKey | ASTXKRNXZNELRF-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |