C25H24N2O4S — CID 10182279
N-[6-[3-(3-cyanopropyl)phenyl]-1-methoxy-6H-benzo[c]chromen-8-yl]methanesulfonamide (PubChem CID 10182279) has the molecular formula C25H24N2O4S and a molecular weight of 448.54 g/mol. Its IUPAC name is N-[6-[3-(3-cyanopropyl)phenyl]-1-methoxy-6H-benzo[c]chromen-8-yl]methanesulfonamide.
| Compound Name | N-[6-[3-(3-cyanopropyl)phenyl]-1-methoxy-6H-benzo[c]chromen-8-yl]methanesulfonamide |
|---|---|
| PubChem CID | 10182279 |
| Molecular Formula | C25H24N2O4S |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | N-[6-[3-(3-cyanopropyl)phenyl]-1-methoxy-6H-benzo[c]chromen-8-yl]methanesulfonamide |
| SMILES | COc1cccc2c1-c1ccc(NS(C)(=O)=O)cc1C(c1cccc(CCCC#N)c1)O2 |
| InChI | InChI=1S/C25H24N2O4S/c1-30-22-10-6-11-23-24(22)20-13-12-19(27-32(2,28)29)16-21(20)25(31-23)18-9-5-8-17(15-18)7-3-4-14-26/h5-6,8-13,15-16,25,27H,3-4,7H2,1-2H3 |
| InChIKey | ZWOFXXHEJHCQSQ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|