C13H14N2O2 — CID 70026864
2-(4-methanehydrazonoylnaphthalen-1-yl)oxyethanol (PubChem CID 70026864) has the molecular formula C13H14N2O2 and a molecular weight of 230.27 g/mol. Its IUPAC name is 2-(4-methanehydrazonoylnaphthalen-1-yl)oxyethanol.
| Compound Name | 2-(4-methanehydrazonoylnaphthalen-1-yl)oxyethanol |
|---|---|
| PubChem CID | 70026864 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 2-(4-methanehydrazonoylnaphthalen-1-yl)oxyethanol |
| SMILES | NN=Cc1ccc(OCCO)c2ccccc12 |
| InChI | InChI=1S/C13H14N2O2/c14-15-9-10-5-6-13(17-8-7-16)12-4-2-1-3-11(10)12/h1-6,9,16H,7-8,14H2 |
| InChIKey | JKSZOHYLJZBKNK-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|