C24H34O3 — CID 70029386
methyl 3-[(8S,9S,10R,13R,14S,17R)-10,13-dimethyl-7-methylidene-3-oxo-2,6,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]propanoate (PubChem CID 70029386) has the molecular formula C24H34O3 and a molecular weight of 370.53 g/mol. Its IUPAC name is methyl 3-[(8S,9S,10R,13R,14S,17R)-10,13-dimethyl-7-methylidene-3-oxo-2,6,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]propanoate.
| Compound Name | methyl 3-[(8S,9S,10R,13R,14S,17R)-10,13-dimethyl-7-methylidene-3-oxo-2,6,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]propanoate |
|---|---|
| PubChem CID | 70029386 |
| Molecular Formula | C24H34O3 |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | methyl 3-[(8S,9S,10R,13R,14S,17R)-10,13-dimethyl-7-methylidene-3-oxo-2,6,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]propanoate |
| SMILES | C=C1CC2=CC(=O)CC[C@]2(C)[C@H]2CC[C@]3(C)[C@@H](CCC(=O)OC)CC[C@H]3[C@H]12 |
| InChI | InChI=1S/C24H34O3/c1-15-13-17-14-18(25)9-11-24(17,3)20-10-12-23(2)16(6-8-21(26)27-4)5-7-19(23)22(15)20/h14,16,19-20,22H,1,5-13H2,2-4H3/t16-,19+,20+,22+,23-,24+/m1/s1 |
| InChIKey | VATGSXMZWXQEQJ-JEJCCYHHSA-N |
| XLogP | 5.25 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|