C33H29N3O3 — CID 70033785
N-(2-benzyl-1,2,3,4-tetrahydronaphthalen-1-yl)-2-(1,3-dioxoisoindol-2-yl)-N-(pyridin-2-ylmethyl)acetamide (PubChem CID 70033785) has the molecular formula C33H29N3O3 and a molecular weight of 515.61 g/mol. Its IUPAC name is N-(2-benzyl-1,2,3,4-tetrahydronaphthalen-1-yl)-2-(1,3-dioxoisoindol-2-yl)-N-(pyridin-2-ylmethyl)acetamide.
| Compound Name | N-(2-benzyl-1,2,3,4-tetrahydronaphthalen-1-yl)-2-(1,3-dioxoisoindol-2-yl)-N-(pyridin-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 70033785 |
| Molecular Formula | C33H29N3O3 |
| Molecular Weight | 515.61 g/mol |
| Exact Mass | 515.22 |
| IUPAC Name | N-(2-benzyl-1,2,3,4-tetrahydronaphthalen-1-yl)-2-(1,3-dioxoisoindol-2-yl)-N-(pyridin-2-ylmethyl)acetamide |
| SMILES | O=C1c2ccccc2C(=O)N1CC(=O)N(Cc1ccccn1)C1c2ccccc2CCC1Cc1ccccc1 |
| InChI | InChI=1S/C33H29N3O3/c37-30(22-36-32(38)28-15-6-7-16-29(28)33(36)39)35(21-26-13-8-9-19-34-26)31-25(20-23-10-2-1-3-11-23)18-17-24-12-4-5-14-27(24)31/h1-16,19,25,31H,17-18,20-22H2 |
| InChIKey | VJMGYHFYAJWSGZ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.61 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|