C35H41N3O10 — CID 70036054
methyl 2-hydroxy-6-[4-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-[(2-oxo-2-phenylmethoxyacetyl)amino]phenyl]propanoyl]amino]butoxy]benzoate (PubChem CID 70036054) has the molecular formula C35H41N3O10 and a molecular weight of 663.72 g/mol. Its IUPAC name is methyl 2-hydroxy-6-[4-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-[(2-oxo-2-phenylmethoxyacetyl)amino]phenyl]propanoyl]amino]butoxy]benzoate.
| Compound Name | methyl 2-hydroxy-6-[4-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-[(2-oxo-2-phenylmethoxyacetyl)amino]phenyl]propanoyl]amino]butoxy]benzoate |
|---|---|
| PubChem CID | 70036054 |
| Molecular Formula | C35H41N3O10 |
| Molecular Weight | 663.72 g/mol |
| Exact Mass | 663.28 |
| IUPAC Name | methyl 2-hydroxy-6-[4-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-[(2-oxo-2-phenylmethoxyacetyl)amino]phenyl]propanoyl]amino]butoxy]benzoate |
| SMILES | COC(=O)c1c(O)cccc1OCCCCNC(=O)[C@H](Cc1ccc(NC(=O)C(=O)OCc2ccccc2)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C35H41N3O10/c1-35(2,3)48-34(44)38-26(30(40)36-19-8-9-20-46-28-14-10-13-27(39)29(28)32(42)45-4)21-23-15-17-25(18-16-23)37-31(41)33(43)47-22-24-11-6-5-7-12-24/h5-7,10-18,26,39H,8-9,19-22H2,1-4H3,(H,36,40)(H,37,41)(H,38,44)/t26-/m0/s1 |
| InChIKey | TXCRAHKMVAOBDP-SANMLTNESA-N |
| XLogP | 4.27 |
| TPSA | 178.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.72 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|