C35H39N3O12 — CID 10009886
2-[4-[(2S)-3-[4-(3-hydroxy-2-methoxycarbonylphenoxy)butylamino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]-N-oxaloanilino]benzoic acid (PubChem CID 10009886) has the molecular formula C35H39N3O12 and a molecular weight of 693.71 g/mol. Its IUPAC name is 2-[4-[(2S)-3-[4-(3-hydroxy-2-methoxycarbonylphenoxy)butylamino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]-N-oxaloanilino]benzoic acid.
| Compound Name | 2-[4-[(2S)-3-[4-(3-hydroxy-2-methoxycarbonylphenoxy)butylamino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]-N-oxaloanilino]benzoic acid |
|---|---|
| PubChem CID | 10009886 |
| Molecular Formula | C35H39N3O12 |
| Molecular Weight | 693.71 g/mol |
| Exact Mass | 693.25 |
| IUPAC Name | 2-[4-[(2S)-3-[4-(3-hydroxy-2-methoxycarbonylphenoxy)butylamino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]-N-oxaloanilino]benzoic acid |
| SMILES | COC(=O)c1c(O)cccc1OCCCCNC(=O)[C@H](Cc1ccc(N(C(=O)C(=O)O)c2ccccc2C(=O)O)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C35H39N3O12/c1-35(2,3)50-34(47)37-24(29(40)36-18-7-8-19-49-27-13-9-12-26(39)28(27)33(46)48-4)20-21-14-16-22(17-15-21)38(30(41)32(44)45)25-11-6-5-10-23(25)31(42)43/h5-6,9-17,24,39H,7-8,18-20H2,1-4H3,(H,36,40)(H,37,47)(H,42,43)(H,44,45)/t24-/m0/s1 |
| InChIKey | LNLMYOKSZGVUEE-DEOSSOPVSA-N |
| XLogP | 4.04 |
| TPSA | 218.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.71 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|