C33H35N3O11 — CID 73350411
2-[4-[[acetyl-[4-(3-hydroxy-2-methoxycarbonylphenoxy)butylcarbamoyl]amino]methyl]-2-ethyl-N-oxaloanilino]benzoic acid (PubChem CID 73350411) has the molecular formula C33H35N3O11 and a molecular weight of 649.65 g/mol. Its IUPAC name is 2-[4-[[acetyl-[4-(3-hydroxy-2-methoxycarbonylphenoxy)butylcarbamoyl]amino]methyl]-2-ethyl-N-oxaloanilino]benzoic acid.
| Compound Name | 2-[4-[[acetyl-[4-(3-hydroxy-2-methoxycarbonylphenoxy)butylcarbamoyl]amino]methyl]-2-ethyl-N-oxaloanilino]benzoic acid |
|---|---|
| PubChem CID | 73350411 |
| Molecular Formula | C33H35N3O11 |
| Molecular Weight | 649.65 g/mol |
| Exact Mass | 649.23 |
| IUPAC Name | 2-[4-[[acetyl-[4-(3-hydroxy-2-methoxycarbonylphenoxy)butylcarbamoyl]amino]methyl]-2-ethyl-N-oxaloanilino]benzoic acid |
| SMILES | CCc1cc(CN(C(C)=O)C(=O)NCCCCOc2cccc(O)c2C(=O)OC)ccc1N(C(=O)C(=O)O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C33H35N3O11/c1-4-22-18-21(14-15-24(22)36(29(39)31(42)43)25-11-6-5-10-23(25)30(40)41)19-35(20(2)37)33(45)34-16-7-8-17-47-27-13-9-12-26(38)28(27)32(44)46-3/h5-6,9-15,18,38H,4,7-8,16-17,19H2,1-3H3,(H,34,45)(H,40,41)(H,42,43) |
| InChIKey | FIIWBWXTPJUZGG-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 200.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.65 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|