C32H33N3O12 — CID 10439239
2-[4-[[(2S)-3-[4-(2-carboxy-N-oxaloanilino)phenyl]-2-(methoxycarbonylamino)propanoyl]amino]butoxy]-6-hydroxy-4-methylbenzoic acid (PubChem CID 10439239) has the molecular formula C32H33N3O12 and a molecular weight of 651.63 g/mol. Its IUPAC name is 2-[4-[[(2S)-3-[4-(2-carboxy-N-oxaloanilino)phenyl]-2-(methoxycarbonylamino)propanoyl]amino]butoxy]-6-hydroxy-4-methylbenzoic acid.
| Compound Name | 2-[4-[[(2S)-3-[4-(2-carboxy-N-oxaloanilino)phenyl]-2-(methoxycarbonylamino)propanoyl]amino]butoxy]-6-hydroxy-4-methylbenzoic acid |
|---|---|
| PubChem CID | 10439239 |
| Molecular Formula | C32H33N3O12 |
| Molecular Weight | 651.63 g/mol |
| Exact Mass | 651.21 |
| IUPAC Name | 2-[4-[[(2S)-3-[4-(2-carboxy-N-oxaloanilino)phenyl]-2-(methoxycarbonylamino)propanoyl]amino]butoxy]-6-hydroxy-4-methylbenzoic acid |
| SMILES | COC(=O)N[C@@H](Cc1ccc(N(C(=O)C(=O)O)c2ccccc2C(=O)O)cc1)C(=O)NCCCCOc1cc(C)cc(O)c1C(=O)O |
| InChI | InChI=1S/C32H33N3O12/c1-18-15-24(36)26(30(41)42)25(16-18)47-14-6-5-13-33-27(37)22(34-32(45)46-2)17-19-9-11-20(12-10-19)35(28(38)31(43)44)23-8-4-3-7-21(23)29(39)40/h3-4,7-12,15-16,22,36H,5-6,13-14,17H2,1-2H3,(H,33,37)(H,34,45)(H,39,40)(H,41,42)(H,43,44)/t22-/m0/s1 |
| InChIKey | QRHFPAREAVMUDG-QFIPXVFZSA-N |
| XLogP | 3.09 |
| TPSA | 229.10 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.63 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|