C38H37N3O12 — CID 22271897
2-[4-[3-[4-(3-hydroxy-2-methoxycarbonyl-5-phenylphenoxy)butylamino]-2-(methoxycarbonylamino)-3-oxopropyl]-N-oxaloanilino]benzoic acid (PubChem CID 22271897) has the molecular formula C38H37N3O12 and a molecular weight of 727.72 g/mol. Its IUPAC name is 2-[4-[3-[4-(3-hydroxy-2-methoxycarbonyl-5-phenylphenoxy)butylamino]-2-(methoxycarbonylamino)-3-oxopropyl]-N-oxaloanilino]benzoic acid.
| Compound Name | 2-[4-[3-[4-(3-hydroxy-2-methoxycarbonyl-5-phenylphenoxy)butylamino]-2-(methoxycarbonylamino)-3-oxopropyl]-N-oxaloanilino]benzoic acid |
|---|---|
| PubChem CID | 22271897 |
| Molecular Formula | C38H37N3O12 |
| Molecular Weight | 727.72 g/mol |
| Exact Mass | 727.24 |
| IUPAC Name | 2-[4-[3-[4-(3-hydroxy-2-methoxycarbonyl-5-phenylphenoxy)butylamino]-2-(methoxycarbonylamino)-3-oxopropyl]-N-oxaloanilino]benzoic acid |
| SMILES | COC(=O)NC(Cc1ccc(N(C(=O)C(=O)O)c2ccccc2C(=O)O)cc1)C(=O)NCCCCOc1cc(-c2ccccc2)cc(O)c1C(=O)OC |
| InChI | InChI=1S/C38H37N3O12/c1-51-37(49)32-30(42)21-25(24-10-4-3-5-11-24)22-31(32)53-19-9-8-18-39-33(43)28(40-38(50)52-2)20-23-14-16-26(17-15-23)41(34(44)36(47)48)29-13-7-6-12-27(29)35(45)46/h3-7,10-17,21-22,28,42H,8-9,18-20H2,1-2H3,(H,39,43)(H,40,50)(H,45,46)(H,47,48) |
| InChIKey | IAKJTICRYFGEDI-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 218.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 53 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.72 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|