C34H35N3O13 — CID 10122761
2-[4-[(2S)-3-[2-[2-(3-hydroxy-2-methoxycarbonylphenoxy)ethoxy]ethylamino]-3-oxo-2-(prop-2-enoxycarbonylamino)propyl]-N-oxaloanilino]benzoic acid (PubChem CID 10122761) has the molecular formula C34H35N3O13 and a molecular weight of 693.66 g/mol. Its IUPAC name is 2-[4-[(2S)-3-[2-[2-(3-hydroxy-2-methoxycarbonylphenoxy)ethoxy]ethylamino]-3-oxo-2-(prop-2-enoxycarbonylamino)propyl]-N-oxaloanilino]benzoic acid.
| Compound Name | 2-[4-[(2S)-3-[2-[2-(3-hydroxy-2-methoxycarbonylphenoxy)ethoxy]ethylamino]-3-oxo-2-(prop-2-enoxycarbonylamino)propyl]-N-oxaloanilino]benzoic acid |
|---|---|
| PubChem CID | 10122761 |
| Molecular Formula | C34H35N3O13 |
| Molecular Weight | 693.66 g/mol |
| Exact Mass | 693.22 |
| IUPAC Name | 2-[4-[(2S)-3-[2-[2-(3-hydroxy-2-methoxycarbonylphenoxy)ethoxy]ethylamino]-3-oxo-2-(prop-2-enoxycarbonylamino)propyl]-N-oxaloanilino]benzoic acid |
| SMILES | C=CCOC(=O)N[C@@H](Cc1ccc(N(C(=O)C(=O)O)c2ccccc2C(=O)O)cc1)C(=O)NCCOCCOc1cccc(O)c1C(=O)OC |
| InChI | InChI=1S/C34H35N3O13/c1-3-16-50-34(46)36-24(29(39)35-15-17-48-18-19-49-27-10-6-9-26(38)28(27)33(45)47-2)20-21-11-13-22(14-12-21)37(30(40)32(43)44)25-8-5-4-7-23(25)31(41)42/h3-14,24,38H,1,15-20H2,2H3,(H,35,39)(H,36,46)(H,41,42)(H,43,44)/t24-/m0/s1 |
| InChIKey | XNGZNXOMBOBILN-DEOSSOPVSA-N |
| XLogP | 2.66 |
| TPSA | 227.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.66 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|