C19H30ClN5O3 — CID 70037533
6-amino-5-chloro-N-[[1-[6-(methylamino)-6-oxohexyl]piperidin-4-yl]methyl]-2-oxo-1H-pyridine-3-carboxamide (PubChem CID 70037533) has the molecular formula C19H30ClN5O3 and a molecular weight of 411.93 g/mol. Its IUPAC name is 6-amino-5-chloro-N-[[1-[6-(methylamino)-6-oxohexyl]piperidin-4-yl]methyl]-2-oxo-1H-pyridine-3-carboxamide.
| Compound Name | 6-amino-5-chloro-N-[[1-[6-(methylamino)-6-oxohexyl]piperidin-4-yl]methyl]-2-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 70037533 |
| Molecular Formula | C19H30ClN5O3 |
| Molecular Weight | 411.93 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | 6-amino-5-chloro-N-[[1-[6-(methylamino)-6-oxohexyl]piperidin-4-yl]methyl]-2-oxo-1H-pyridine-3-carboxamide |
| SMILES | CNC(=O)CCCCCN1CCC(CNC(=O)c2cc(Cl)c(N)[nH]c2=O)CC1 |
| InChI | InChI=1S/C19H30ClN5O3/c1-22-16(26)5-3-2-4-8-25-9-6-13(7-10-25)12-23-18(27)14-11-15(20)17(21)24-19(14)28/h11,13H,2-10,12H2,1H3,(H,22,26)(H,23,27)(H3,21,24,28) |
| InChIKey | MYVMIVQWXJHUMJ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.93 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|