C19H18ClF5N4O2 — CID 87976917
6-amino-5-chloro-N-[[1-[difluoro-(2,3,4-trifluorophenyl)methyl]piperidin-4-yl]methyl]-2-oxo-1H-pyridine-3-carboxamide (PubChem CID 87976917) has the molecular formula C19H18ClF5N4O2 and a molecular weight of 464.82 g/mol. Its IUPAC name is 6-amino-5-chloro-N-[[1-[difluoro-(2,3,4-trifluorophenyl)methyl]piperidin-4-yl]methyl]-2-oxo-1H-pyridine-3-carboxamide.
| Compound Name | 6-amino-5-chloro-N-[[1-[difluoro-(2,3,4-trifluorophenyl)methyl]piperidin-4-yl]methyl]-2-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 87976917 |
| Molecular Formula | C19H18ClF5N4O2 |
| Molecular Weight | 464.82 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | 6-amino-5-chloro-N-[[1-[difluoro-(2,3,4-trifluorophenyl)methyl]piperidin-4-yl]methyl]-2-oxo-1H-pyridine-3-carboxamide |
| SMILES | Nc1[nH]c(=O)c(C(=O)NCC2CCN(C(F)(F)c3ccc(F)c(F)c3F)CC2)cc1Cl |
| InChI | InChI=1S/C19H18ClF5N4O2/c20-12-7-10(18(31)28-16(12)26)17(30)27-8-9-3-5-29(6-4-9)19(24,25)11-1-2-13(21)15(23)14(11)22/h1-2,7,9H,3-6,8H2,(H,27,30)(H3,26,28,31) |
| InChIKey | JUJACXQMOIKNRO-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.82 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|