C19H21N5O4 — CID 70038007
(3R,4S,5R)-2-(2-amino-8-phenyl-6-prop-2-enylpurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 70038007) has the molecular formula C19H21N5O4 and a molecular weight of 383.41 g/mol. Its IUPAC name is (3R,4S,5R)-2-(2-amino-8-phenyl-6-prop-2-enylpurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (3R,4S,5R)-2-(2-amino-8-phenyl-6-prop-2-enylpurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 70038007 |
| Molecular Formula | C19H21N5O4 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | (3R,4S,5R)-2-(2-amino-8-phenyl-6-prop-2-enylpurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | C=CCc1nc(N)nc2c1nc(-c1ccccc1)n2C1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C19H21N5O4/c1-2-6-11-13-17(23-19(20)21-11)24(16(22-13)10-7-4-3-5-8-10)18-15(27)14(26)12(9-25)28-18/h2-5,7-8,12,14-15,18,25-27H,1,6,9H2,(H2,20,21,23)/t12-,14-,15-,18?/m1/s1 |
| InChIKey | QQBBZTVGBZDABX-PZGKNFOESA-N |
| XLogP | 0.42 |
| TPSA | 139.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|