C7H10N2OS2 — CID 70038292
N-propan-2-yl-2-sulfanylidene-3H-1,3-thiazole-5-carboxamide (PubChem CID 70038292) has the molecular formula C7H10N2OS2 and a molecular weight of 202.30 g/mol. Its IUPAC name is N-propan-2-yl-2-sulfanylidene-3H-1,3-thiazole-5-carboxamide.
| Compound Name | N-propan-2-yl-2-sulfanylidene-3H-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 70038292 |
| Molecular Formula | C7H10N2OS2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.02 |
| IUPAC Name | N-propan-2-yl-2-sulfanylidene-3H-1,3-thiazole-5-carboxamide |
| SMILES | CC(C)NC(=O)c1c[nH]c(=S)s1 |
| InChI | InChI=1S/C7H10N2OS2/c1-4(2)9-6(10)5-3-8-7(11)12-5/h3-4H,1-2H3,(H,8,11)(H,9,10) |
| InChIKey | URDCAZRDHZSGAQ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|