About 1-[2,4-dimethoxy-5-(trifluoromethyl)phenyl]-1-(5-methyl-1,2-oxazol-3-yl)urea
1-[2,4-dimethoxy-5-(trifluoromethyl)phenyl]-1-(5-methyl-1,2-oxazol-3-yl)urea (PubChem CID 70038811) has the molecular formula C14H14F3N3O4
and a molecular weight of 345.28 g/mol. Its IUPAC name is 1-[2,4-dimethoxy-5-(trifluoromethyl)phenyl]-1-(5-methyl-1,2-oxazol-3-yl)urea.
Molecular Properties
| Compound Name | 1-[2,4-dimethoxy-5-(trifluoromethyl)phenyl]-1-(5-methyl-1,2-oxazol-3-yl)urea |
| PubChem CID | 70038811 |
| Molecular Formula | C14H14F3N3O4 |
| Molecular Weight | 345.28 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 1-[2,4-dimethoxy-5-(trifluoromethyl)phenyl]-1-(5-methyl-1,2-oxazol-3-yl)urea |
| SMILES | COc1cc(OC)c(C(F)(F)F)cc1N(C(N)=O)c1cc(C)on1 |
| InChI | InChI=1S/C14H14F3N3O4/c1-7-4-12(19-24-7)20(13(18)21)9-5-8(14(15,16)17)10(22-2)6-11(9)23-3/h4-6H,1-3H3,(H2,18,21) |
| InChIKey | BBMITLIIJYSATL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.28 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[2,4-dimethoxy-5-(trifluoromethyl)phenyl]-1-(5-methyl-1,2-oxazol-3-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2,4-dimethoxy-5-(trifluoromethyl)phenyl]-1-(5-methyl-1,2-oxazol-3-yl)urea?
The IUPAC name of 1-[2,4-dimethoxy-5-(trifluoromethyl)phenyl]-1-(5-methyl-1,2-oxazol-3-yl)urea (CID 70038811) is 1-[2,4-dimethoxy-5-(trifluoromethyl)phenyl]-1-(5-methyl-1,2-oxazol-3-yl)urea.
What is the SMILES notation for 1-[2,4-dimethoxy-5-(trifluoromethyl)phenyl]-1-(5-methyl-1,2-oxazol-3-yl)urea?
The canonical SMILES for 1-[2,4-dimethoxy-5-(trifluoromethyl)phenyl]-1-(5-methyl-1,2-oxazol-3-yl)urea is COc1cc(OC)c(C(F)(F)F)cc1N(C(N)=O)c1cc(C)on1.
What is the InChIKey of 1-[2,4-dimethoxy-5-(trifluoromethyl)phenyl]-1-(5-methyl-1,2-oxazol-3-yl)urea?
The InChIKey is BBMITLIIJYSATL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14F3N3O4/c1-7-4-12(19-24-7)20(13(18)21)9-5-8(14(15,16)17)10(22-2)6-11(9)23-3/h4-6H,1-3H3,(H2,18,21).
What are the key properties of 1-[2,4-dimethoxy-5-(trifluoromethyl)phenyl]-1-(5-methyl-1,2-oxazol-3-yl)urea?
1-[2,4-dimethoxy-5-(trifluoromethyl)phenyl]-1-(5-methyl-1,2-oxazol-3-yl)urea has a molecular weight of 345.28 g/mol, XLogP of 3.24, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2,4-dimethoxy-5-(trifluoromethyl)phenyl]-1-(5-methyl-1,2-oxazol-3-yl)urea is sourced from PubChem (CID 70038811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).