C20H23N3O2 — CID 70040039
N-[(2S,3R)-2-hydroxy-6-naphthalen-2-ylhexan-3-yl]-1H-imidazole-5-carboxamide (PubChem CID 70040039) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is N-[(2S,3R)-2-hydroxy-6-naphthalen-2-ylhexan-3-yl]-1H-imidazole-5-carboxamide.
| Compound Name | N-[(2S,3R)-2-hydroxy-6-naphthalen-2-ylhexan-3-yl]-1H-imidazole-5-carboxamide |
|---|---|
| PubChem CID | 70040039 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | N-[(2S,3R)-2-hydroxy-6-naphthalen-2-ylhexan-3-yl]-1H-imidazole-5-carboxamide |
| SMILES | C[C@H](O)[C@@H](CCCc1ccc2ccccc2c1)NC(=O)c1cnc[nH]1 |
| InChI | InChI=1S/C20H23N3O2/c1-14(24)18(23-20(25)19-12-21-13-22-19)8-4-5-15-9-10-16-6-2-3-7-17(16)11-15/h2-3,6-7,9-14,18,24H,4-5,8H2,1H3,(H,21,22)(H,23,25)/t14-,18+/m0/s1 |
| InChIKey | UCFQJIRCDFRMAV-KBXCAEBGSA-N |
| XLogP | 3.07 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |