C20H30N4O3 — CID 70098682
N-[(3R,4S)-1-[2-[3-(dimethylamino)propoxy]phenyl]-4-hydroxypentan-3-yl]-1H-imidazole-5-carboxamide (PubChem CID 70098682) has the molecular formula C20H30N4O3 and a molecular weight of 374.49 g/mol. Its IUPAC name is N-[(3R,4S)-1-[2-[3-(dimethylamino)propoxy]phenyl]-4-hydroxypentan-3-yl]-1H-imidazole-5-carboxamide.
| Compound Name | N-[(3R,4S)-1-[2-[3-(dimethylamino)propoxy]phenyl]-4-hydroxypentan-3-yl]-1H-imidazole-5-carboxamide |
|---|---|
| PubChem CID | 70098682 |
| Molecular Formula | C20H30N4O3 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | N-[(3R,4S)-1-[2-[3-(dimethylamino)propoxy]phenyl]-4-hydroxypentan-3-yl]-1H-imidazole-5-carboxamide |
| SMILES | C[C@H](O)[C@@H](CCc1ccccc1OCCCN(C)C)NC(=O)c1cnc[nH]1 |
| InChI | InChI=1S/C20H30N4O3/c1-15(25)17(23-20(26)18-13-21-14-22-18)10-9-16-7-4-5-8-19(16)27-12-6-11-24(2)3/h4-5,7-8,13-15,17,25H,6,9-12H2,1-3H3,(H,21,22)(H,23,26)/t15-,17+/m0/s1 |
| InChIKey | DBBQHFMWUXUEJH-DOTOQJQBSA-N |
| XLogP | 1.85 |
| TPSA | 90.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|