C32H37FN4O8 — CID 70040656
6-[3-fluoro-2-[[3-methoxy-4-[[2-(3-methyl-2-propan-2-ylcyclohexyl)oxyacetyl]amino]anilino]methyl]-6-nitrophenoxy]pyridine-3-carboxylic acid (PubChem CID 70040656) has the molecular formula C32H37FN4O8 and a molecular weight of 624.67 g/mol. Its IUPAC name is 6-[3-fluoro-2-[[3-methoxy-4-[[2-(3-methyl-2-propan-2-ylcyclohexyl)oxyacetyl]amino]anilino]methyl]-6-nitrophenoxy]pyridine-3-carboxylic acid.
| Compound Name | 6-[3-fluoro-2-[[3-methoxy-4-[[2-(3-methyl-2-propan-2-ylcyclohexyl)oxyacetyl]amino]anilino]methyl]-6-nitrophenoxy]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 70040656 |
| Molecular Formula | C32H37FN4O8 |
| Molecular Weight | 624.67 g/mol |
| Exact Mass | 624.26 |
| IUPAC Name | 6-[3-fluoro-2-[[3-methoxy-4-[[2-(3-methyl-2-propan-2-ylcyclohexyl)oxyacetyl]amino]anilino]methyl]-6-nitrophenoxy]pyridine-3-carboxylic acid |
| SMILES | COc1cc(NCc2c(F)ccc([N+](=O)[O-])c2Oc2ccc(C(=O)O)cn2)ccc1NC(=O)COC1CCCC(C)C1C(C)C |
| InChI | InChI=1S/C32H37FN4O8/c1-18(2)30-19(3)6-5-7-26(30)44-17-28(38)36-24-11-9-21(14-27(24)43-4)34-16-22-23(33)10-12-25(37(41)42)31(22)45-29-13-8-20(15-35-29)32(39)40/h8-15,18-19,26,30,34H,5-7,16-17H2,1-4H3,(H,36,38)(H,39,40) |
| InChIKey | NSEBGQOHQZGIRB-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 162.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.67 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|