C33H39FN4O8 — CID 70039125
methyl 6-[4-fluoro-5-[[3-methoxy-4-[[2-(3-methyl-2-propan-2-ylcyclohexyl)oxyacetyl]amino]anilino]methyl]-2-nitrophenoxy]pyridine-2-carboxylate (PubChem CID 70039125) has the molecular formula C33H39FN4O8 and a molecular weight of 638.69 g/mol. Its IUPAC name is methyl 6-[4-fluoro-5-[[3-methoxy-4-[[2-(3-methyl-2-propan-2-ylcyclohexyl)oxyacetyl]amino]anilino]methyl]-2-nitrophenoxy]pyridine-2-carboxylate.
| Compound Name | methyl 6-[4-fluoro-5-[[3-methoxy-4-[[2-(3-methyl-2-propan-2-ylcyclohexyl)oxyacetyl]amino]anilino]methyl]-2-nitrophenoxy]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 70039125 |
| Molecular Formula | C33H39FN4O8 |
| Molecular Weight | 638.69 g/mol |
| Exact Mass | 638.28 |
| IUPAC Name | methyl 6-[4-fluoro-5-[[3-methoxy-4-[[2-(3-methyl-2-propan-2-ylcyclohexyl)oxyacetyl]amino]anilino]methyl]-2-nitrophenoxy]pyridine-2-carboxylate |
| SMILES | COC(=O)c1cccc(Oc2cc(CNc3ccc(NC(=O)COC4CCCC(C)C4C(C)C)c(OC)c3)c(F)cc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C33H39FN4O8/c1-19(2)32-20(3)8-6-10-27(32)45-18-30(39)36-24-13-12-22(15-28(24)43-4)35-17-21-14-29(26(38(41)42)16-23(21)34)46-31-11-7-9-25(37-31)33(40)44-5/h7,9,11-16,19-20,27,32,35H,6,8,10,17-18H2,1-5H3,(H,36,39) |
| InChIKey | IIGMSFCDHLRDKK-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 151.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.69 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|