C16H23N5O+2 — CID 7004201
[(4S)-4-azaniumyl-5-(naphthalen-2-ylamino)-5-oxopentyl]-(diaminomethylidene)azanium (PubChem CID 7004201) has the molecular formula C16H23N5O+2 and a molecular weight of 301.39 g/mol. Its IUPAC name is [(4S)-4-azaniumyl-5-(naphthalen-2-ylamino)-5-oxopentyl]-(diaminomethylidene)azanium.
| Compound Name | [(4S)-4-azaniumyl-5-(naphthalen-2-ylamino)-5-oxopentyl]-(diaminomethylidene)azanium |
|---|---|
| PubChem CID | 7004201 |
| Molecular Formula | C16H23N5O+2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | [(4S)-4-azaniumyl-5-(naphthalen-2-ylamino)-5-oxopentyl]-(diaminomethylidene)azanium |
| SMILES | NC(N)=[NH+]CCC[C@H]([NH3+])C(=O)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C16H21N5O/c17-14(6-3-9-20-16(18)19)15(22)21-13-8-7-11-4-1-2-5-12(11)10-13/h1-2,4-5,7-8,10,14H,3,6,9,17H2,(H,21,22)(H4,18,19,20)/p+2/t14-/m0/s1 |
| InChIKey | DICSXQHGGOAUNU-AWEZNQCLSA-P |
| XLogP | -1.48 |
| TPSA | 122.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|