C24H30N4O5 — CID 70042461
3-[(6aR)-7-methyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinolin-4-yl]-1,1-diethylurea;(Z)-but-2-enedioic acid (PubChem CID 70042461) has the molecular formula C24H30N4O5 and a molecular weight of 454.53 g/mol. Its IUPAC name is 3-[(6aR)-7-methyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinolin-4-yl]-1,1-diethylurea;(Z)-but-2-enedioic acid.
| Compound Name | 3-[(6aR)-7-methyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinolin-4-yl]-1,1-diethylurea;(Z)-but-2-enedioic acid |
|---|---|
| PubChem CID | 70042461 |
| Molecular Formula | C24H30N4O5 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | 3-[(6aR)-7-methyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinolin-4-yl]-1,1-diethylurea;(Z)-but-2-enedioic acid |
| SMILES | CCN(CC)C(=O)Nn1cc2c3c(cccc31)C1=CCCN(C)[C@@H]1C2.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C20H26N4O.C4H4O4/c1-4-23(5-2)20(25)21-24-13-14-12-18-15(9-7-11-22(18)3)16-8-6-10-17(24)19(14)16;5-3(6)1-2-4(7)8/h6,8-10,13,18H,4-5,7,11-12H2,1-3H3,(H,21,25);1-2H,(H,5,6)(H,7,8)/b;2-1-/t18-;/m1./s1 |
| InChIKey | LXAQHVXOUYATQQ-PSFGXCKZSA-N |
| XLogP | 3.00 |
| TPSA | 115.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|