C23H34N4OSi — CID 57005445
3-[(6aR)-7-methyl-5-trimethylsilyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinolin-4-yl]-1,1-diethylurea (PubChem CID 57005445) has the molecular formula C23H34N4OSi and a molecular weight of 410.64 g/mol. Its IUPAC name is 3-[(6aR)-7-methyl-5-trimethylsilyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinolin-4-yl]-1,1-diethylurea.
| Compound Name | 3-[(6aR)-7-methyl-5-trimethylsilyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinolin-4-yl]-1,1-diethylurea |
|---|---|
| PubChem CID | 57005445 |
| Molecular Formula | C23H34N4OSi |
| Molecular Weight | 410.64 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | 3-[(6aR)-7-methyl-5-trimethylsilyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinolin-4-yl]-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)Nn1c([Si](C)(C)C)c2c3c(cccc31)C1=CCCN(C)[C@@H]1C2 |
| InChI | InChI=1S/C23H34N4OSi/c1-7-26(8-2)23(28)24-27-19-13-9-11-17-16-12-10-14-25(3)20(16)15-18(21(17)19)22(27)29(4,5)6/h9,11-13,20H,7-8,10,14-15H2,1-6H3,(H,24,28)/t20-/m1/s1 |
| InChIKey | GCLXGKQOXYFDMQ-HXUWFJFHSA-N |
| XLogP | 3.84 |
| TPSA | 40.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.64 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|