C27H32N4OS — CID 57172997
3-[(6aR)-7-methyl-5-(4-methylphenyl)sulfanyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinolin-4-yl]-1,1-diethylurea (PubChem CID 57172997) has the molecular formula C27H32N4OS and a molecular weight of 460.65 g/mol. Its IUPAC name is 3-[(6aR)-7-methyl-5-(4-methylphenyl)sulfanyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinolin-4-yl]-1,1-diethylurea.
| Compound Name | 3-[(6aR)-7-methyl-5-(4-methylphenyl)sulfanyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinolin-4-yl]-1,1-diethylurea |
|---|---|
| PubChem CID | 57172997 |
| Molecular Formula | C27H32N4OS |
| Molecular Weight | 460.65 g/mol |
| Exact Mass | 460.23 |
| IUPAC Name | 3-[(6aR)-7-methyl-5-(4-methylphenyl)sulfanyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinolin-4-yl]-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)Nn1c(Sc2ccc(C)cc2)c2c3c(cccc31)C1=CCCN(C)[C@@H]1C2 |
| InChI | InChI=1S/C27H32N4OS/c1-5-30(6-2)27(32)28-31-23-11-7-9-21-20-10-8-16-29(4)24(20)17-22(25(21)23)26(31)33-19-14-12-18(3)13-15-19/h7,9-15,24H,5-6,8,16-17H2,1-4H3,(H,28,32)/t24-/m1/s1 |
| InChIKey | OQMWFSUGNILQSB-XMMPIXPASA-N |
| XLogP | 5.75 |
| TPSA | 40.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.65 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |