C23H32N4S — CID 57019490
3-[(6aR)-5-methyl-7-propyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinolin-4-yl]-1,1-diethylthiourea (PubChem CID 57019490) has the molecular formula C23H32N4S and a molecular weight of 396.60 g/mol. Its IUPAC name is 3-[(6aR)-5-methyl-7-propyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinolin-4-yl]-1,1-diethylthiourea.
| Compound Name | 3-[(6aR)-5-methyl-7-propyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinolin-4-yl]-1,1-diethylthiourea |
|---|---|
| PubChem CID | 57019490 |
| Molecular Formula | C23H32N4S |
| Molecular Weight | 396.60 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | 3-[(6aR)-5-methyl-7-propyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinolin-4-yl]-1,1-diethylthiourea |
| SMILES | CCCN1CCC=C2c3cccc4c3c(c(C)n4NC(=S)N(CC)CC)C[C@H]21 |
| InChI | InChI=1S/C23H32N4S/c1-5-13-26-14-9-11-17-18-10-8-12-20-22(18)19(15-21(17)26)16(4)27(20)24-23(28)25(6-2)7-3/h8,10-12,21H,5-7,9,13-15H2,1-4H3,(H,24,28)/t21-/m1/s1 |
| InChIKey | GEKWRZTWBXNXKH-OAQYLSRUSA-N |
| XLogP | 4.54 |
| TPSA | 23.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.60 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|