C20H27BrN4S — CID 57088044
3-[(6aR,10aR)-5-bromo-7-methyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-4-yl]-1,1-diethylthiourea (PubChem CID 57088044) has the molecular formula C20H27BrN4S and a molecular weight of 435.44 g/mol. Its IUPAC name is 3-[(6aR,10aR)-5-bromo-7-methyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-4-yl]-1,1-diethylthiourea.
| Compound Name | 3-[(6aR,10aR)-5-bromo-7-methyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-4-yl]-1,1-diethylthiourea |
|---|---|
| PubChem CID | 57088044 |
| Molecular Formula | C20H27BrN4S |
| Molecular Weight | 435.44 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | 3-[(6aR,10aR)-5-bromo-7-methyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-4-yl]-1,1-diethylthiourea |
| SMILES | CCN(CC)C(=S)Nn1c(Br)c2c3c(cccc31)[C@H]1CCCN(C)[C@@H]1C2 |
| InChI | InChI=1S/C20H27BrN4S/c1-4-24(5-2)20(26)22-25-16-10-6-8-14-13-9-7-11-23(3)17(13)12-15(18(14)16)19(25)21/h6,8,10,13,17H,4-5,7,9,11-12H2,1-3H3,(H,22,26)/t13-,17-/m1/s1 |
| InChIKey | IIKDXENJUVKDEH-CXAGYDPISA-N |
| XLogP | 4.31 |
| TPSA | 23.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.44 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|