C25H38N4O — CID 57201760
3-[(6aR,10aR)-5,7-dipropyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-4-yl]-1,1-diethylurea (PubChem CID 57201760) has the molecular formula C25H38N4O and a molecular weight of 410.61 g/mol. Its IUPAC name is 3-[(6aR,10aR)-5,7-dipropyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-4-yl]-1,1-diethylurea.
| Compound Name | 3-[(6aR,10aR)-5,7-dipropyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-4-yl]-1,1-diethylurea |
|---|---|
| PubChem CID | 57201760 |
| Molecular Formula | C25H38N4O |
| Molecular Weight | 410.61 g/mol |
| Exact Mass | 410.30 |
| IUPAC Name | 3-[(6aR,10aR)-5,7-dipropyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-4-yl]-1,1-diethylurea |
| SMILES | CCCc1c2c3c(cccc3n1NC(=O)N(CC)CC)[C@H]1CCCN(CCC)[C@@H]1C2 |
| InChI | InChI=1S/C25H38N4O/c1-5-11-21-20-17-23-18(13-10-16-28(23)15-6-2)19-12-9-14-22(24(19)20)29(21)26-25(30)27(7-3)8-4/h9,12,14,18,23H,5-8,10-11,13,15-17H2,1-4H3,(H,26,30)/t18-,23-/m1/s1 |
| InChIKey | YWHPQAZDXOWXNX-WZONZLPQSA-N |
| XLogP | 5.11 |
| TPSA | 40.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.61 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |