C21H28N2O2 — CID 67885308
methyl (6aR,10aR)-5-ethyl-7-propyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-4-carboxylate (PubChem CID 67885308) has the molecular formula C21H28N2O2 and a molecular weight of 340.47 g/mol. Its IUPAC name is methyl (6aR,10aR)-5-ethyl-7-propyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-4-carboxylate.
| Compound Name | methyl (6aR,10aR)-5-ethyl-7-propyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 67885308 |
| Molecular Formula | C21H28N2O2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | methyl (6aR,10aR)-5-ethyl-7-propyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-4-carboxylate |
| SMILES | CCCN1CCC[C@@H]2c3cccc4c3c(c(CC)n4C(=O)OC)C[C@H]21 |
| InChI | InChI=1S/C21H28N2O2/c1-4-11-22-12-7-9-14-15-8-6-10-18-20(15)16(13-19(14)22)17(5-2)23(18)21(24)25-3/h6,8,10,14,19H,4-5,7,9,11-13H2,1-3H3/t14-,19-/m1/s1 |
| InChIKey | PYENVWPFSCMLKK-AUUYWEPGSA-N |
| XLogP | 4.33 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |