C21H27N3O — CID 67885614
2-[(6aR,10aR)-5-(methoxymethyl)-7-propyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-4-yl]acetonitrile (PubChem CID 67885614) has the molecular formula C21H27N3O and a molecular weight of 337.47 g/mol. Its IUPAC name is 2-[(6aR,10aR)-5-(methoxymethyl)-7-propyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-4-yl]acetonitrile.
| Compound Name | 2-[(6aR,10aR)-5-(methoxymethyl)-7-propyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-4-yl]acetonitrile |
|---|---|
| PubChem CID | 67885614 |
| Molecular Formula | C21H27N3O |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.22 |
| IUPAC Name | 2-[(6aR,10aR)-5-(methoxymethyl)-7-propyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-4-yl]acetonitrile |
| SMILES | CCCN1CCC[C@@H]2c3cccc4c3c(c(COC)n4CC#N)C[C@H]21 |
| InChI | InChI=1S/C21H27N3O/c1-3-10-23-11-5-7-15-16-6-4-8-18-21(16)17(13-19(15)23)20(14-25-2)24(18)12-9-22/h4,6,8,15,19H,3,5,7,10-14H2,1-2H3/t15-,19-/m1/s1 |
| InChIKey | WNLIULLMHMOJNQ-DNVCBOLYSA-N |
| XLogP | 3.83 |
| TPSA | 41.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|