C19H23N3S — CID 57274660
(6aR)-4-isothiocyanato-5-methyl-7-propyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline (PubChem CID 57274660) has the molecular formula C19H23N3S and a molecular weight of 325.48 g/mol. Its IUPAC name is (6aR)-4-isothiocyanato-5-methyl-7-propyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline.
| Compound Name | (6aR)-4-isothiocyanato-5-methyl-7-propyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline |
|---|---|
| PubChem CID | 57274660 |
| Molecular Formula | C19H23N3S |
| Molecular Weight | 325.48 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | (6aR)-4-isothiocyanato-5-methyl-7-propyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline |
| SMILES | CCCN1CCCC2c3cccc4c3c(c(C)n4N=C=S)C[C@H]21 |
| InChI | InChI=1S/C19H23N3S/c1-3-9-21-10-5-7-14-15-6-4-8-17-19(15)16(11-18(14)21)13(2)22(17)20-12-23/h4,6,8,14,18H,3,5,7,9-11H2,1-2H3/t14?,18-/m1/s1 |
| InChIKey | XYVFGGOAXCWDSF-XPKAQORNSA-N |
| XLogP | 4.33 |
| TPSA | 20.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.48 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|