C22H32N4O2 — CID 57147810
3-[(6aR,10aR)-5-(methoxymethyl)-7-propyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-4-yl]-1,1-dimethylurea (PubChem CID 57147810) has the molecular formula C22H32N4O2 and a molecular weight of 384.52 g/mol. Its IUPAC name is 3-[(6aR,10aR)-5-(methoxymethyl)-7-propyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-4-yl]-1,1-dimethylurea.
| Compound Name | 3-[(6aR,10aR)-5-(methoxymethyl)-7-propyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-4-yl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 57147810 |
| Molecular Formula | C22H32N4O2 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | 3-[(6aR,10aR)-5-(methoxymethyl)-7-propyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-4-yl]-1,1-dimethylurea |
| SMILES | CCCN1CCC[C@@H]2c3cccc4c3c(c(COC)n4NC(=O)N(C)C)C[C@H]21 |
| InChI | InChI=1S/C22H32N4O2/c1-5-11-25-12-7-9-15-16-8-6-10-18-21(16)17(13-19(15)25)20(14-28-4)26(18)23-22(27)24(2)3/h6,8,10,15,19H,5,7,9,11-14H2,1-4H3,(H,23,27)/t15-,19-/m1/s1 |
| InChIKey | DFSKZZOWDBOTFL-DNVCBOLYSA-N |
| XLogP | 3.53 |
| TPSA | 49.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |