C26H39N5O2 — CID 57186554
3-[(6aR,10aR)-7-ethyl-5-(morpholin-4-ylmethyl)-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-4-yl]-1,1-diethylurea (PubChem CID 57186554) has the molecular formula C26H39N5O2 and a molecular weight of 453.63 g/mol. Its IUPAC name is 3-[(6aR,10aR)-7-ethyl-5-(morpholin-4-ylmethyl)-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-4-yl]-1,1-diethylurea.
| Compound Name | 3-[(6aR,10aR)-7-ethyl-5-(morpholin-4-ylmethyl)-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-4-yl]-1,1-diethylurea |
|---|---|
| PubChem CID | 57186554 |
| Molecular Formula | C26H39N5O2 |
| Molecular Weight | 453.63 g/mol |
| Exact Mass | 453.31 |
| IUPAC Name | 3-[(6aR,10aR)-7-ethyl-5-(morpholin-4-ylmethyl)-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-4-yl]-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)Nn1c(CN2CCOCC2)c2c3c(cccc31)[C@H]1CCCN(CC)[C@@H]1C2 |
| InChI | InChI=1S/C26H39N5O2/c1-4-29(5-2)26(32)27-31-22-11-7-9-20-19-10-8-12-30(6-3)23(19)17-21(25(20)22)24(31)18-28-13-15-33-16-14-28/h7,9,11,19,23H,4-6,8,10,12-18H2,1-3H3,(H,27,32)/t19-,23-/m1/s1 |
| InChIKey | GGRFTDGNXBJITI-AUSIDOKSSA-N |
| XLogP | 3.60 |
| TPSA | 52.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.63 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |