C27H41N5O2 — CID 57021694
3-[(6aR,10aR)-7-ethyl-5-(2-morpholin-4-ylethyl)-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-1,1-diethylurea (PubChem CID 57021694) has the molecular formula C27H41N5O2 and a molecular weight of 467.66 g/mol. Its IUPAC name is 3-[(6aR,10aR)-7-ethyl-5-(2-morpholin-4-ylethyl)-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-1,1-diethylurea.
| Compound Name | 3-[(6aR,10aR)-7-ethyl-5-(2-morpholin-4-ylethyl)-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-1,1-diethylurea |
|---|---|
| PubChem CID | 57021694 |
| Molecular Formula | C27H41N5O2 |
| Molecular Weight | 467.66 g/mol |
| Exact Mass | 467.33 |
| IUPAC Name | 3-[(6aR,10aR)-7-ethyl-5-(2-morpholin-4-ylethyl)-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)NC1C[C@@H]2c3cccc4[nH]c(CCN5CCOCC5)c(c34)C[C@H]2N(CC)C1 |
| InChI | InChI=1S/C27H41N5O2/c1-4-31(5-2)27(33)28-19-16-21-20-8-7-9-24-26(20)22(17-25(21)32(6-3)18-19)23(29-24)10-11-30-12-14-34-15-13-30/h7-9,19,21,25,29H,4-6,10-18H2,1-3H3,(H,28,33)/t19?,21-,25-/m1/s1 |
| InChIKey | ZGCKHFJGJQGURG-ZMFCXZKHSA-N |
| XLogP | 3.20 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.66 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |