C25H36N4OS — CID 57145364
3-[(6aR,10aR)-7-(cyclopropylmethyl)-5-(methylsulfanylmethyl)-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-4-yl]-1,1-diethylurea (PubChem CID 57145364) has the molecular formula C25H36N4OS and a molecular weight of 440.66 g/mol. Its IUPAC name is 3-[(6aR,10aR)-7-(cyclopropylmethyl)-5-(methylsulfanylmethyl)-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-4-yl]-1,1-diethylurea.
| Compound Name | 3-[(6aR,10aR)-7-(cyclopropylmethyl)-5-(methylsulfanylmethyl)-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-4-yl]-1,1-diethylurea |
|---|---|
| PubChem CID | 57145364 |
| Molecular Formula | C25H36N4OS |
| Molecular Weight | 440.66 g/mol |
| Exact Mass | 440.26 |
| IUPAC Name | 3-[(6aR,10aR)-7-(cyclopropylmethyl)-5-(methylsulfanylmethyl)-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-4-yl]-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)Nn1c(CSC)c2c3c(cccc31)[C@H]1CCCN(CC3CC3)[C@@H]1C2 |
| InChI | InChI=1S/C25H36N4OS/c1-4-27(5-2)25(30)26-29-21-10-6-8-19-18-9-7-13-28(15-17-11-12-17)22(18)14-20(24(19)21)23(29)16-31-3/h6,8,10,17-18,22H,4-5,7,9,11-16H2,1-3H3,(H,26,30)/t18-,22-/m1/s1 |
| InChIKey | XSGJRXSMLGMOAM-XMSQKQJNSA-N |
| XLogP | 5.02 |
| TPSA | 40.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.66 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |