C22H30BrClN4O — CID 57211237
3-[(6aR,10aR)-5-bromo-2-chloro-7-propyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-4-yl]-1,1-diethylurea (PubChem CID 57211237) has the molecular formula C22H30BrClN4O and a molecular weight of 481.87 g/mol. Its IUPAC name is 3-[(6aR,10aR)-5-bromo-2-chloro-7-propyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-4-yl]-1,1-diethylurea.
| Compound Name | 3-[(6aR,10aR)-5-bromo-2-chloro-7-propyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-4-yl]-1,1-diethylurea |
|---|---|
| PubChem CID | 57211237 |
| Molecular Formula | C22H30BrClN4O |
| Molecular Weight | 481.87 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | 3-[(6aR,10aR)-5-bromo-2-chloro-7-propyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-4-yl]-1,1-diethylurea |
| SMILES | CCCN1CCC[C@@H]2c3cc(Cl)cc4c3c(c(Br)n4NC(=O)N(CC)CC)C[C@H]21 |
| InChI | InChI=1S/C22H30BrClN4O/c1-4-9-27-10-7-8-15-16-11-14(24)12-19-20(16)17(13-18(15)27)21(23)28(19)25-22(29)26(5-2)6-3/h11-12,15,18H,4-10,13H2,1-3H3,(H,25,29)/t15-,18-/m1/s1 |
| InChIKey | KZGXZQMRCNOKHH-CRAIPNDOSA-N |
| XLogP | 5.58 |
| TPSA | 40.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.87 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |