C25H38N4O — CID 56985127
3-[(6aR,10aR)-2-propan-2-yl-7-propyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-4-yl]-1,1-diethylurea (PubChem CID 56985127) has the molecular formula C25H38N4O and a molecular weight of 410.61 g/mol. Its IUPAC name is 3-[(6aR,10aR)-2-propan-2-yl-7-propyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-4-yl]-1,1-diethylurea.
| Compound Name | 3-[(6aR,10aR)-2-propan-2-yl-7-propyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-4-yl]-1,1-diethylurea |
|---|---|
| PubChem CID | 56985127 |
| Molecular Formula | C25H38N4O |
| Molecular Weight | 410.61 g/mol |
| Exact Mass | 410.30 |
| IUPAC Name | 3-[(6aR,10aR)-2-propan-2-yl-7-propyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-4-yl]-1,1-diethylurea |
| SMILES | CCCN1CCC[C@@H]2c3cc(C(C)C)cc4c3c(cn4NC(=O)N(CC)CC)C[C@H]21 |
| InChI | InChI=1S/C25H38N4O/c1-6-11-28-12-9-10-20-21-13-18(17(4)5)14-23-24(21)19(15-22(20)28)16-29(23)26-25(30)27(7-2)8-3/h13-14,16-17,20,22H,6-12,15H2,1-5H3,(H,26,30)/t20-,22-/m1/s1 |
| InChIKey | BTHBLNFCSTVQTN-IFMALSPDSA-N |
| XLogP | 5.28 |
| TPSA | 40.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.61 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |