C23H35N5O — CID 57301173
3-[(6aR,10aR)-2-[(dimethylamino)methyl]-7-methyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-4-yl]-1,1-diethylurea (PubChem CID 57301173) has the molecular formula C23H35N5O and a molecular weight of 397.57 g/mol. Its IUPAC name is 3-[(6aR,10aR)-2-[(dimethylamino)methyl]-7-methyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-4-yl]-1,1-diethylurea.
| Compound Name | 3-[(6aR,10aR)-2-[(dimethylamino)methyl]-7-methyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-4-yl]-1,1-diethylurea |
|---|---|
| PubChem CID | 57301173 |
| Molecular Formula | C23H35N5O |
| Molecular Weight | 397.57 g/mol |
| Exact Mass | 397.28 |
| IUPAC Name | 3-[(6aR,10aR)-2-[(dimethylamino)methyl]-7-methyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-4-yl]-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)Nn1cc2c3c(cc(CN(C)C)cc31)[C@H]1CCCN(C)[C@@H]1C2 |
| InChI | InChI=1S/C23H35N5O/c1-6-27(7-2)23(29)24-28-15-17-13-20-18(9-8-10-26(20)5)19-11-16(14-25(3)4)12-21(28)22(17)19/h11-12,15,18,20H,6-10,13-14H2,1-5H3,(H,24,29)/t18-,20-/m1/s1 |
| InChIKey | DZFRDEQDXHLBOI-UYAOXDASSA-N |
| XLogP | 3.44 |
| TPSA | 43.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.57 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |