C20H29N5O — CID 57115425
3-[(6aR,10aR)-2-amino-7-methyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-4-yl]-1,1-diethylurea (PubChem CID 57115425) has the molecular formula C20H29N5O and a molecular weight of 355.49 g/mol. Its IUPAC name is 3-[(6aR,10aR)-2-amino-7-methyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-4-yl]-1,1-diethylurea.
| Compound Name | 3-[(6aR,10aR)-2-amino-7-methyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-4-yl]-1,1-diethylurea |
|---|---|
| PubChem CID | 57115425 |
| Molecular Formula | C20H29N5O |
| Molecular Weight | 355.49 g/mol |
| Exact Mass | 355.24 |
| IUPAC Name | 3-[(6aR,10aR)-2-amino-7-methyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-4-yl]-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)Nn1cc2c3c(cc(N)cc31)[C@H]1CCCN(C)[C@@H]1C2 |
| InChI | InChI=1S/C20H29N5O/c1-4-24(5-2)20(26)22-25-12-13-9-17-15(7-6-8-23(17)3)16-10-14(21)11-18(25)19(13)16/h10-12,15,17H,4-9,21H2,1-3H3,(H,22,26)/t15-,17-/m1/s1 |
| InChIKey | QUNPYTHMNOOUDK-NVXWUHKLSA-N |
| XLogP | 2.96 |
| TPSA | 66.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.49 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|