C18H24N2OS — CID 174883345
2-[[(6aS,10aS)-7-methyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-4-yl]methylsulfanyl]ethanol (PubChem CID 174883345) has the molecular formula C18H24N2OS and a molecular weight of 316.47 g/mol. Its IUPAC name is 2-[[(6aS,10aS)-7-methyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-4-yl]methylsulfanyl]ethanol.
| Compound Name | 2-[[(6aS,10aS)-7-methyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-4-yl]methylsulfanyl]ethanol |
|---|---|
| PubChem CID | 174883345 |
| Molecular Formula | C18H24N2OS |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 2-[[(6aS,10aS)-7-methyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-4-yl]methylsulfanyl]ethanol |
| SMILES | CN1CCC[C@H]2c3cccc4c3c(cn4CSCCO)C[C@@H]21 |
| InChI | InChI=1S/C18H24N2OS/c1-19-7-3-5-14-15-4-2-6-16-18(15)13(10-17(14)19)11-20(16)12-22-9-8-21/h2,4,6,11,14,17,21H,3,5,7-10,12H2,1H3/t14-,17-/m0/s1 |
| InChIKey | RBNZFXQZPVAOCQ-YOEHRIQHSA-N |
| XLogP | 3.06 |
| TPSA | 28.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|