C24H36N4O7 — CID 70409618
3-[(6aR,10aR)-7-methyl-5,5a,6,6a,8,9,10,10a-octahydroindolo[4,3-fg]quinolin-4-yl]-1,1-diethylurea;2,3-dihydroxybutanedioic acid (PubChem CID 70409618) has the molecular formula C24H36N4O7 and a molecular weight of 492.57 g/mol. Its IUPAC name is 3-[(6aR,10aR)-7-methyl-5,5a,6,6a,8,9,10,10a-octahydroindolo[4,3-fg]quinolin-4-yl]-1,1-diethylurea;2,3-dihydroxybutanedioic acid.
| Compound Name | 3-[(6aR,10aR)-7-methyl-5,5a,6,6a,8,9,10,10a-octahydroindolo[4,3-fg]quinolin-4-yl]-1,1-diethylurea;2,3-dihydroxybutanedioic acid |
|---|---|
| PubChem CID | 70409618 |
| Molecular Formula | C24H36N4O7 |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.26 |
| IUPAC Name | 3-[(6aR,10aR)-7-methyl-5,5a,6,6a,8,9,10,10a-octahydroindolo[4,3-fg]quinolin-4-yl]-1,1-diethylurea;2,3-dihydroxybutanedioic acid |
| SMILES | CCN(CC)C(=O)NN1CC2C[C@@H]3[C@H](CCCN3C)c3cccc1c32.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C20H30N4O.C4H6O6/c1-4-23(5-2)20(25)21-24-13-14-12-18-15(9-7-11-22(18)3)16-8-6-10-17(24)19(14)16;5-1(3(7)8)2(6)4(9)10/h6,8,10,14-15,18H,4-5,7,9,11-13H2,1-3H3,(H,21,25);1-2,5-6H,(H,7,8)(H,9,10)/t14?,15-,18-;/m1./s1 |
| InChIKey | BMNSRESHIBXOCX-RHFNFTDCSA-N |
| XLogP | 1.02 |
| TPSA | 153.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |