C20H30N4O2 — CID 57237156
3-[(6aR,10aR)-1-hydroxy-7-methyl-5,5a,6,6a,8,9,10,10a-octahydroindolo[4,3-fg]quinolin-4-yl]-1,1-diethylurea (PubChem CID 57237156) has the molecular formula C20H30N4O2 and a molecular weight of 358.49 g/mol. Its IUPAC name is 3-[(6aR,10aR)-1-hydroxy-7-methyl-5,5a,6,6a,8,9,10,10a-octahydroindolo[4,3-fg]quinolin-4-yl]-1,1-diethylurea.
| Compound Name | 3-[(6aR,10aR)-1-hydroxy-7-methyl-5,5a,6,6a,8,9,10,10a-octahydroindolo[4,3-fg]quinolin-4-yl]-1,1-diethylurea |
|---|---|
| PubChem CID | 57237156 |
| Molecular Formula | C20H30N4O2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | 3-[(6aR,10aR)-1-hydroxy-7-methyl-5,5a,6,6a,8,9,10,10a-octahydroindolo[4,3-fg]quinolin-4-yl]-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)NN1CC2C[C@@H]3[C@H](CCCN3C)c3c(O)ccc1c32 |
| InChI | InChI=1S/C20H30N4O2/c1-4-23(5-2)20(26)21-24-12-13-11-16-14(7-6-10-22(16)3)19-17(25)9-8-15(24)18(13)19/h8-9,13-14,16,25H,4-7,10-12H2,1-3H3,(H,21,26)/t13?,14-,16+/m0/s1 |
| InChIKey | XLWRCHQFPYHZSZ-JGKCFBKVSA-N |
| XLogP | 2.84 |
| TPSA | 59.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |