C26H41N5O4 — CID 70043572
(2S)-N-[(2S,3R)-4-[(2S,3aS,6aS)-2-(tert-butylcarbamoyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl]-3-hydroxy-1-phenylbutan-2-yl]-2-aminobutanediamide (PubChem CID 70043572) has the molecular formula C26H41N5O4 and a molecular weight of 487.65 g/mol. Its IUPAC name is (2S)-N-[(2S,3R)-4-[(2S,3aS,6aS)-2-(tert-butylcarbamoyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl]-3-hydroxy-1-phenylbutan-2-yl]-2-aminobutanediamide.
| Compound Name | (2S)-N-[(2S,3R)-4-[(2S,3aS,6aS)-2-(tert-butylcarbamoyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl]-3-hydroxy-1-phenylbutan-2-yl]-2-aminobutanediamide |
|---|---|
| PubChem CID | 70043572 |
| Molecular Formula | C26H41N5O4 |
| Molecular Weight | 487.65 g/mol |
| Exact Mass | 487.32 |
| IUPAC Name | (2S)-N-[(2S,3R)-4-[(2S,3aS,6aS)-2-(tert-butylcarbamoyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl]-3-hydroxy-1-phenylbutan-2-yl]-2-aminobutanediamide |
| SMILES | CC(C)(C)NC(=O)[C@@H]1C[C@@H]2CCC[C@@H]2N1C[C@@H](O)[C@H](Cc1ccccc1)NC(=O)[C@@H](N)CC(N)=O |
| InChI | InChI=1S/C26H41N5O4/c1-26(2,3)30-25(35)21-13-17-10-7-11-20(17)31(21)15-22(32)19(12-16-8-5-4-6-9-16)29-24(34)18(27)14-23(28)33/h4-6,8-9,17-22,32H,7,10-15,27H2,1-3H3,(H2,28,33)(H,29,34)(H,30,35)/t17-,18-,19-,20-,21-,22+/m0/s1 |
| InChIKey | COQUFZFSYBQXJD-KKFDQILXSA-N |
| XLogP | 0.44 |
| TPSA | 150.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.65 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |