C28H45N5O4 — CID 18650727
(2S)-N-[(2R)-1-[(3S,4aS,8aS)-3-(tert-butylcarbamoyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-hydroxy-4-phenylbutyl]-2-aminobutanediamide (PubChem CID 18650727) has the molecular formula C28H45N5O4 and a molecular weight of 515.70 g/mol. Its IUPAC name is (2S)-N-[(2R)-1-[(3S,4aS,8aS)-3-(tert-butylcarbamoyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-hydroxy-4-phenylbutyl]-2-aminobutanediamide.
| Compound Name | (2S)-N-[(2R)-1-[(3S,4aS,8aS)-3-(tert-butylcarbamoyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-hydroxy-4-phenylbutyl]-2-aminobutanediamide |
|---|---|
| PubChem CID | 18650727 |
| Molecular Formula | C28H45N5O4 |
| Molecular Weight | 515.70 g/mol |
| Exact Mass | 515.35 |
| IUPAC Name | (2S)-N-[(2R)-1-[(3S,4aS,8aS)-3-(tert-butylcarbamoyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-hydroxy-4-phenylbutyl]-2-aminobutanediamide |
| SMILES | CC(C)(C)NC(=O)[C@@H]1C[C@@H]2CCCC[C@@H]2CN1C(NC(=O)[C@@H](N)CC(N)=O)[C@H](O)CCc1ccccc1 |
| InChI | InChI=1S/C28H45N5O4/c1-28(2,3)32-27(37)22-15-19-11-7-8-12-20(19)17-33(22)25(31-26(36)21(29)16-24(30)35)23(34)14-13-18-9-5-4-6-10-18/h4-6,9-10,19-23,25,34H,7-8,11-17,29H2,1-3H3,(H2,30,35)(H,31,36)(H,32,37)/t19-,20+,21-,22-,23+,25?/m0/s1 |
| InChIKey | GDSJWONRPCFTCF-BBJCRLHCSA-N |
| XLogP | 1.42 |
| TPSA | 150.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.70 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |