C18H24N2O2 — CID 70048755
2-[1-(4-methylpiperidin-1-yl)propyl]-1H-indole-3-carboxylic acid (PubChem CID 70048755) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is 2-[1-(4-methylpiperidin-1-yl)propyl]-1H-indole-3-carboxylic acid.
| Compound Name | 2-[1-(4-methylpiperidin-1-yl)propyl]-1H-indole-3-carboxylic acid |
|---|---|
| PubChem CID | 70048755 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 2-[1-(4-methylpiperidin-1-yl)propyl]-1H-indole-3-carboxylic acid |
| SMILES | CCC(c1[nH]c2ccccc2c1C(=O)O)N1CCC(C)CC1 |
| InChI | InChI=1S/C18H24N2O2/c1-3-15(20-10-8-12(2)9-11-20)17-16(18(21)22)13-6-4-5-7-14(13)19-17/h4-7,12,15,19H,3,8-11H2,1-2H3,(H,21,22) |
| InChIKey | CUGYJHYSBNPMFJ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |