C25H39N5O4 — CID 70053190
2-[4-[3-[4-(4-benzylpiperazin-1-yl)butyl]-4-methyl-2-oxo-1,3-oxazolidin-5-yl]piperazin-1-yl]acetic acid (PubChem CID 70053190) has the molecular formula C25H39N5O4 and a molecular weight of 473.62 g/mol. Its IUPAC name is 2-[4-[3-[4-(4-benzylpiperazin-1-yl)butyl]-4-methyl-2-oxo-1,3-oxazolidin-5-yl]piperazin-1-yl]acetic acid.
| Compound Name | 2-[4-[3-[4-(4-benzylpiperazin-1-yl)butyl]-4-methyl-2-oxo-1,3-oxazolidin-5-yl]piperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 70053190 |
| Molecular Formula | C25H39N5O4 |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.30 |
| IUPAC Name | 2-[4-[3-[4-(4-benzylpiperazin-1-yl)butyl]-4-methyl-2-oxo-1,3-oxazolidin-5-yl]piperazin-1-yl]acetic acid |
| SMILES | CC1C(N2CCN(CC(=O)O)CC2)OC(=O)N1CCCCN1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C25H39N5O4/c1-21-24(29-17-15-28(16-18-29)20-23(31)32)34-25(33)30(21)10-6-5-9-26-11-13-27(14-12-26)19-22-7-3-2-4-8-22/h2-4,7-8,21,24H,5-6,9-20H2,1H3,(H,31,32) |
| InChIKey | RCPJGVJPGDGXJU-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|