C25H44N4O2 — CID 70053602
(8R,9S,10S,13R,14R,17S)-10,13-dimethyl-17-[1-[2-(1,4,5,6-tetrahydropyrimidin-2-yl)hydrazinyl]ethyl]-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,14-diol (PubChem CID 70053602) has the molecular formula C25H44N4O2 and a molecular weight of 432.65 g/mol. Its IUPAC name is (8R,9S,10S,13R,14R,17S)-10,13-dimethyl-17-[1-[2-(1,4,5,6-tetrahydropyrimidin-2-yl)hydrazinyl]ethyl]-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,14-diol.
| Compound Name | (8R,9S,10S,13R,14R,17S)-10,13-dimethyl-17-[1-[2-(1,4,5,6-tetrahydropyrimidin-2-yl)hydrazinyl]ethyl]-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,14-diol |
|---|---|
| PubChem CID | 70053602 |
| Molecular Formula | C25H44N4O2 |
| Molecular Weight | 432.65 g/mol |
| Exact Mass | 432.35 |
| IUPAC Name | (8R,9S,10S,13R,14R,17S)-10,13-dimethyl-17-[1-[2-(1,4,5,6-tetrahydropyrimidin-2-yl)hydrazinyl]ethyl]-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,14-diol |
| SMILES | CC(NNC1=NCCCN1)[C@H]1CC[C@@]2(O)[C@@H]3CCC4CC(O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C25H44N4O2/c1-16(28-29-22-26-13-4-14-27-22)19-9-12-25(31)21-6-5-17-15-18(30)7-10-23(17,2)20(21)8-11-24(19,25)3/h16-21,28,30-31H,4-15H2,1-3H3,(H2,26,27,29)/t16?,17?,18?,19-,20+,21-,23+,24-,25-/m1/s1 |
| InChIKey | YHTIPVNEAZUSRQ-RHQLQUPXSA-N |
| XLogP | 2.95 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.65 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|