C25H44N4O2 — CID 22869490
(3S,5R,8R,9S,10S,13R,14S,17S)-17-[3-[2-(4,5-dihydro-1H-imidazol-2-yl)hydrazinyl]propyl]-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,14-diol (PubChem CID 22869490) has the molecular formula C25H44N4O2 and a molecular weight of 432.65 g/mol. Its IUPAC name is (3S,5R,8R,9S,10S,13R,14S,17S)-17-[3-[2-(4,5-dihydro-1H-imidazol-2-yl)hydrazinyl]propyl]-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,14-diol.
| Compound Name | (3S,5R,8R,9S,10S,13R,14S,17S)-17-[3-[2-(4,5-dihydro-1H-imidazol-2-yl)hydrazinyl]propyl]-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,14-diol |
|---|---|
| PubChem CID | 22869490 |
| Molecular Formula | C25H44N4O2 |
| Molecular Weight | 432.65 g/mol |
| Exact Mass | 432.35 |
| IUPAC Name | (3S,5R,8R,9S,10S,13R,14S,17S)-17-[3-[2-(4,5-dihydro-1H-imidazol-2-yl)hydrazinyl]propyl]-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,14-diol |
| SMILES | C[C@]12CC[C@H](O)C[C@H]1CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](CCCNNC3=NCCN3)CC[C@]12O |
| InChI | InChI=1S/C25H44N4O2/c1-23-10-8-19(30)16-18(23)5-6-21-20(23)9-11-24(2)17(7-12-25(21,24)31)4-3-13-28-29-22-26-14-15-27-22/h17-21,28,30-31H,3-16H2,1-2H3,(H2,26,27,29)/t17-,18+,19-,20-,21+,23-,24+,25-/m0/s1 |
| InChIKey | HKTBQLNFTKGVOW-BPIGZEMDSA-N |
| XLogP | 2.95 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.65 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|